C24H30F3O6S- — CID 177111952
2-[3-[2-(1-adamantyl)butan-2-yloxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate (PubChem CID 177111952) has the molecular formula C24H30F3O6S- and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-[3-[2-(1-adamantyl)butan-2-yloxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate.
| Compound Name | 2-[3-[2-(1-adamantyl)butan-2-yloxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177111952 |
| Molecular Formula | C24H30F3O6S- |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 2-[3-[2-(1-adamantyl)butan-2-yloxy]-4-(trifluoromethyl)benzoyl]oxyethanesulfonate |
| SMILES | CCC(C)(Oc1cc(C(=O)OCCS(=O)(=O)[O-])ccc1C(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H31F3O6S/c1-3-22(2,23-12-15-8-16(13-23)10-17(9-15)14-23)33-20-11-18(4-5-19(20)24(25,26)27)21(28)32-6-7-34(29,30)31/h4-5,11,15-17H,3,6-10,12-14H2,1-2H3,(H,29,30,31)/p-1 |
| InChIKey | ZLLOPRSXVLSKOL-UHFFFAOYSA-M |
| XLogP | 5.17 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|