C27H41FO9S — CID 177112204
2-[3,4-bis(1-cyclopentyloxy-2-methylpropoxy)-5-fluorobenzoyl]oxyethanesulfonic acid (PubChem CID 177112204) has the molecular formula C27H41FO9S and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-[3,4-bis(1-cyclopentyloxy-2-methylpropoxy)-5-fluorobenzoyl]oxyethanesulfonic acid.
| Compound Name | 2-[3,4-bis(1-cyclopentyloxy-2-methylpropoxy)-5-fluorobenzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 177112204 |
| Molecular Formula | C27H41FO9S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 2-[3,4-bis(1-cyclopentyloxy-2-methylpropoxy)-5-fluorobenzoyl]oxyethanesulfonic acid |
| SMILES | CC(C)C(Oc1cc(C(=O)OCCS(=O)(=O)O)cc(F)c1OC(OC1CCCC1)C(C)C)OC1CCCC1 |
| InChI | InChI=1S/C27H41FO9S/c1-17(2)26(34-20-9-5-6-10-20)36-23-16-19(25(29)33-13-14-38(30,31)32)15-22(28)24(23)37-27(18(3)4)35-21-11-7-8-12-21/h15-18,20-21,26-27H,5-14H2,1-4H3,(H,30,31,32) |
| InChIKey | WBHTURYLXCGWMH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|