C15H28O — CID 177113729
5,6-ditert-butyl-4,4-dimethyl-2,3-dihydropyran (PubChem CID 177113729) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 5,6-ditert-butyl-4,4-dimethyl-2,3-dihydropyran.
| Compound Name | 5,6-ditert-butyl-4,4-dimethyl-2,3-dihydropyran |
|---|---|
| PubChem CID | 177113729 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 5,6-ditert-butyl-4,4-dimethyl-2,3-dihydropyran |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)C(C)(C)CCO1 |
| InChI | InChI=1S/C15H28O/c1-13(2,3)11-12(14(4,5)6)16-10-9-15(11,7)8/h9-10H2,1-8H3 |
| InChIKey | XWSZHXKHHZJMNN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |