C45H41NS — CID 177113959
N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]dibenzothiophen-3-amine (PubChem CID 177113959) has the molecular formula C45H41NS and a molecular weight of 627.90 g/mol. Its IUPAC name is N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]dibenzothiophen-3-amine.
| Compound Name | N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]dibenzothiophen-3-amine |
|---|---|
| PubChem CID | 177113959 |
| Molecular Formula | C45H41NS |
| Molecular Weight | 627.90 g/mol |
| Exact Mass | 627.30 |
| IUPAC Name | N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]dibenzothiophen-3-amine |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)c3ccccc3-c3ccc(Nc4ccc5c(c4)sc4ccccc45)cc32)cc1 |
| InChI | InChI=1S/C45H41NS/c1-43(2,3)29-15-19-31(20-16-29)45(32-21-17-30(18-22-32)44(4,5)6)39-13-9-7-11-35(39)36-25-23-33(27-40(36)45)46-34-24-26-38-37-12-8-10-14-41(37)47-42(38)28-34/h7-28,46H,1-6H3 |
| InChIKey | MBQHASSVXHVCSK-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.90 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |