About CID 177114475
CID 177114475 (PubChem CID 177114475) has the molecular formula C17H32NO2Si3
and a molecular weight of 366.71 g/mol.
Molecular Properties
| Compound Name | CID 177114475 |
| PubChem CID | 177114475 |
| Molecular Formula | C17H32NO2Si3 |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | — |
| SMILES | C=Cc1cccc([Si](OC)OCCN([Si](C)(C)C)[Si](C)(C)C)c1 |
| InChI | InChI=1S/C17H32NO2Si3/c1-9-16-11-10-12-17(15-16)21(19-2)20-14-13-18(22(3,4)5)23(6,7)8/h9-12,15H,1,13-14H2,2-8H3 |
| InChIKey | VUSCXKCOVLKTCP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177114475 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177114475?
The IUPAC name of CID 177114475 (CID 177114475) is not available.
What is the SMILES notation for CID 177114475?
The canonical SMILES for CID 177114475 is C=Cc1cccc([Si](OC)OCCN([Si](C)(C)C)[Si](C)(C)C)c1.
What is the InChIKey of CID 177114475?
The InChIKey is VUSCXKCOVLKTCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32NO2Si3/c1-9-16-11-10-12-17(15-16)21(19-2)20-14-13-18(22(3,4)5)23(6,7)8/h9-12,15H,1,13-14H2,2-8H3.
What are the key properties of CID 177114475?
CID 177114475 has a molecular weight of 366.71 g/mol, XLogP of 3.66, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177114475 is sourced from PubChem (CID 177114475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).