About 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine
1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine (PubChem CID 177114520) has the molecular formula C10H29NO3Si3
and a molecular weight of 295.60 g/mol. Its IUPAC name is 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine.
Molecular Properties
| Compound Name | 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine |
| PubChem CID | 177114520 |
| Molecular Formula | C10H29NO3Si3 |
| Molecular Weight | 295.60 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine |
| SMILES | CO[Si](CN([Si](C)(C)C)[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C10H29NO3Si3/c1-12-17(13-2,14-3)10-11(15(4,5)6)16(7,8)9/h10H2,1-9H3 |
| InChIKey | WMTXCHQKMREPOH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine?
The IUPAC name of 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine (CID 177114520) is 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine.
What is the SMILES notation for 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine?
The canonical SMILES for 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine is CO[Si](CN([Si](C)(C)C)[Si](C)(C)C)(OC)OC.
What is the InChIKey of 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine?
The InChIKey is WMTXCHQKMREPOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H29NO3Si3/c1-12-17(13-2,14-3)10-11(15(4,5)6)16(7,8)9/h10H2,1-9H3.
What are the key properties of 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine?
1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine has a molecular weight of 295.60 g/mol, XLogP of 2.38, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-trimethoxysilyl-N,N-bis(trimethylsilyl)methanamine is sourced from PubChem (CID 177114520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).