C31H46Cl2N4O4S — CID 177116379
1-butyl-3-[8-[[4-[[(1S,2S)-4,6-dichloro-2-(dimethylamino)-2,3-dihydro-1H-inden-1-yl]oxy]-3-methylphenyl]sulfonylamino]octyl]urea (PubChem CID 177116379) has the molecular formula C31H46Cl2N4O4S and a molecular weight of 641.71 g/mol. Its IUPAC name is 1-butyl-3-[8-[[4-[[(1S,2S)-4,6-dichloro-2-(dimethylamino)-2,3-dihydro-1H-inden-1-yl]oxy]-3-methylphenyl]sulfonylamino]octyl]urea.
| Compound Name | 1-butyl-3-[8-[[4-[[(1S,2S)-4,6-dichloro-2-(dimethylamino)-2,3-dihydro-1H-inden-1-yl]oxy]-3-methylphenyl]sulfonylamino]octyl]urea |
|---|---|
| PubChem CID | 177116379 |
| Molecular Formula | C31H46Cl2N4O4S |
| Molecular Weight | 641.71 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | 1-butyl-3-[8-[[4-[[(1S,2S)-4,6-dichloro-2-(dimethylamino)-2,3-dihydro-1H-inden-1-yl]oxy]-3-methylphenyl]sulfonylamino]octyl]urea |
| SMILES | CCCCNC(=O)NCCCCCCCCNS(=O)(=O)c1ccc(O[C@H]2c3cc(Cl)cc(Cl)c3C[C@@H]2N(C)C)c(C)c1 |
| InChI | InChI=1S/C31H46Cl2N4O4S/c1-5-6-15-34-31(38)35-16-11-9-7-8-10-12-17-36-42(39,40)24-13-14-29(22(2)18-24)41-30-26-19-23(32)20-27(33)25(26)21-28(30)37(3)4/h13-14,18-20,28,30,36H,5-12,15-17,21H2,1-4H3,(H2,34,35,38)/t28-,30-/m0/s1 |
| InChIKey | GLXKYXPHRHUSEN-JDXGNMNLSA-N |
| XLogP | 6.63 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.71 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|