C11H23NO — CID 177116525
2-[(3R)-1-tert-butylpyrrolidin-3-yl]propan-2-ol (PubChem CID 177116525) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 2-[(3R)-1-tert-butylpyrrolidin-3-yl]propan-2-ol.
| Compound Name | 2-[(3R)-1-tert-butylpyrrolidin-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 177116525 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 2-[(3R)-1-tert-butylpyrrolidin-3-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@@H]1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C11H23NO/c1-10(2,3)12-7-6-9(8-12)11(4,5)13/h9,13H,6-8H2,1-5H3/t9-/m1/s1 |
| InChIKey | GDSSUCCDGRINOF-SECBINFHSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |