C12H9F3N4O2 — CID 177116721
6-[(E)-3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (PubChem CID 177116721) has the molecular formula C12H9F3N4O2 and a molecular weight of 298.22 g/mol. Its IUPAC name is 6-[(E)-3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 6-[(E)-3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 177116721 |
| Molecular Formula | C12H9F3N4O2 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 6-[(E)-3-amino-4,4,4-trifluoro-1-iminobut-2-en-2-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| SMILES | [H]/N=C/C(=C(\N)C(F)(F)F)c1ccc2cc(C(=O)O)[nH]c2n1 |
| InChI | InChI=1S/C12H9F3N4O2/c13-12(14,15)9(17)6(4-16)7-2-1-5-3-8(11(20)21)19-10(5)18-7/h1-4,16H,17H2,(H,18,19)(H,20,21)/b9-6+,16-4+ |
| InChIKey | LFJFOJAYRAVCOQ-SVDPZPGRSA-N |
| XLogP | 2.14 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|