C21H14N4O9S — CID 177117705
2-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 177117705) has the molecular formula C21H14N4O9S and a molecular weight of 498.43 g/mol. Its IUPAC name is 2-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 177117705 |
| Molecular Formula | C21H14N4O9S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 2-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cn1c(=O)c2cc3c(=O)n(CCOc4no[n+]([O-])c4S(=O)(=O)c4ccccc4)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C21H14N4O9S/c1-23-17(26)12-9-14-15(10-13(12)18(23)27)20(29)24(19(14)28)7-8-33-16-21(25(30)34-22-16)35(31,32)11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | BMPATNFYLCXUKA-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 174.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|