C17H16O6 — CID 177117831
(6aS,11bR)-7-methyl-6,11b-dihydroindeno[2,1-c]chromene-3,6a,7,9,10-pentol (PubChem CID 177117831) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is (6aS,11bR)-7-methyl-6,11b-dihydroindeno[2,1-c]chromene-3,6a,7,9,10-pentol.
| Compound Name | (6aS,11bR)-7-methyl-6,11b-dihydroindeno[2,1-c]chromene-3,6a,7,9,10-pentol |
|---|---|
| PubChem CID | 177117831 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (6aS,11bR)-7-methyl-6,11b-dihydroindeno[2,1-c]chromene-3,6a,7,9,10-pentol |
| SMILES | CC1(O)c2cc(O)c(O)cc2[C@@H]2c3ccc(O)cc3OC[C@@]21O |
| InChI | InChI=1S/C17H16O6/c1-16(21)11-6-13(20)12(19)5-10(11)15-9-3-2-8(18)4-14(9)23-7-17(15,16)22/h2-6,15,18-22H,7H2,1H3/t15-,16?,17+/m0/s1 |
| InChIKey | SDRDFLAQTYYNBF-RPCGPGEBSA-N |
| XLogP | 1.28 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|