C16H12F2O5 — CID 177117854
(6aS,11bR)-7,7-difluoro-6,11b-dihydroindeno[2,1-c]chromene-3,6a,9,10-tetrol (PubChem CID 177117854) has the molecular formula C16H12F2O5 and a molecular weight of 322.26 g/mol. Its IUPAC name is (6aS,11bR)-7,7-difluoro-6,11b-dihydroindeno[2,1-c]chromene-3,6a,9,10-tetrol.
| Compound Name | (6aS,11bR)-7,7-difluoro-6,11b-dihydroindeno[2,1-c]chromene-3,6a,9,10-tetrol |
|---|---|
| PubChem CID | 177117854 |
| Molecular Formula | C16H12F2O5 |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (6aS,11bR)-7,7-difluoro-6,11b-dihydroindeno[2,1-c]chromene-3,6a,9,10-tetrol |
| SMILES | Oc1ccc2c(c1)OC[C@@]1(O)[C@@H]2c2cc(O)c(O)cc2C1(F)F |
| InChI | InChI=1S/C16H12F2O5/c17-16(18)10-5-12(21)11(20)4-9(10)14-8-2-1-7(19)3-13(8)23-6-15(14,16)22/h1-5,14,19-22H,6H2/t14-,15+/m0/s1 |
| InChIKey | BDBPZWWZIWZVJT-LSDHHAIUSA-N |
| XLogP | 2.16 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|