About CID 177118271
CID 177118271 (PubChem CID 177118271) has the molecular formula C25H35N5O3
and a molecular weight of 453.59 g/mol.
Molecular Properties
| Compound Name | CID 177118271 |
| PubChem CID | 177118271 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | — |
| SMILES | C[C@@H]1NCCCN(c2nccc(-c3onc4c3CCC[C@@]43CCCCC34OCCO4)n2)[C@H]1C |
| InChI | InChI=1S/C25H35N5O3/c1-17-18(2)30(14-6-12-26-17)23-27-13-8-20(28-23)21-19-7-5-10-24(22(19)29-33-21)9-3-4-11-25(24)31-15-16-32-25/h8,13,17-18,26H,3-7,9-12,14-16H2,1-2H3/t17-,18-,24-/m0/s1 |
| InChIKey | NGKCULFYNMFMLV-XFAGBWLFSA-N |
| XLogP | 3.60 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 177118271 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177118271?
The IUPAC name of CID 177118271 (CID 177118271) is not available.
What is the SMILES notation for CID 177118271?
The canonical SMILES for CID 177118271 is C[C@@H]1NCCCN(c2nccc(-c3onc4c3CCC[C@@]43CCCCC34OCCO4)n2)[C@H]1C.
What is the InChIKey of CID 177118271?
The InChIKey is NGKCULFYNMFMLV-XFAGBWLFSA-N. The full InChI is InChI=1S/C25H35N5O3/c1-17-18(2)30(14-6-12-26-17)23-27-13-8-20(28-23)21-19-7-5-10-24(22(19)29-33-21)9-3-4-11-25(24)31-15-16-32-25/h8,13,17-18,26H,3-7,9-12,14-16H2,1-2H3/t17-,18-,24-/m0/s1.
What are the key properties of CID 177118271?
CID 177118271 has a molecular weight of 453.59 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177118271 is sourced from PubChem (CID 177118271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).