C24H21N3O4S2 — CID 177118731
tert-butyl 2-[6-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]-2-methylthieno[2,3-d]pyrimidin-4-yl]sulfanylacetate (PubChem CID 177118731) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is tert-butyl 2-[6-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]-2-methylthieno[2,3-d]pyrimidin-4-yl]sulfanylacetate.
| Compound Name | tert-butyl 2-[6-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]-2-methylthieno[2,3-d]pyrimidin-4-yl]sulfanylacetate |
|---|---|
| PubChem CID | 177118731 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | tert-butyl 2-[6-[3-(1,3-dioxoisoindol-2-yl)prop-1-ynyl]-2-methylthieno[2,3-d]pyrimidin-4-yl]sulfanylacetate |
| SMILES | Cc1nc(SCC(=O)OC(C)(C)C)c2cc(C#CCN3C(=O)c4ccccc4C3=O)sc2n1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-14-25-20(32-13-19(28)31-24(2,3)4)18-12-15(33-21(18)26-14)8-7-11-27-22(29)16-9-5-6-10-17(16)23(27)30/h5-6,9-10,12H,11,13H2,1-4H3 |
| InChIKey | MMGQPRBQUODBPY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|