C28H39N5O4Si — CID 177119374
[4-methoxy-3-[5-[4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]phenyl] N-(cyclohexylmethyl)carbamate (PubChem CID 177119374) has the molecular formula C28H39N5O4Si and a molecular weight of 537.74 g/mol. Its IUPAC name is [4-methoxy-3-[5-[4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]phenyl] N-(cyclohexylmethyl)carbamate.
| Compound Name | [4-methoxy-3-[5-[4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]phenyl] N-(cyclohexylmethyl)carbamate |
|---|---|
| PubChem CID | 177119374 |
| Molecular Formula | C28H39N5O4Si |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | [4-methoxy-3-[5-[4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]phenyl] N-(cyclohexylmethyl)carbamate |
| SMILES | COc1ccc(OC(=O)NCC2CCCCC2)cc1-c1cncc(-c2nncn2COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C28H39N5O4Si/c1-35-26-11-10-24(37-28(34)30-16-21-8-6-5-7-9-21)15-25(26)22-14-23(18-29-17-22)27-32-31-19-33(27)20-36-12-13-38(2,3)4/h10-11,14-15,17-19,21H,5-9,12-13,16,20H2,1-4H3,(H,30,34) |
| InChIKey | DPJYJIXYEGTGHN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|