About 6-hydroxy-2,3,7-trimethylnon-5-en-4-one
6-hydroxy-2,3,7-trimethylnon-5-en-4-one (PubChem CID 177119848) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 6-hydroxy-2,3,7-trimethylnon-5-en-4-one.
Molecular Properties
| Compound Name | 6-hydroxy-2,3,7-trimethylnon-5-en-4-one |
| PubChem CID | 177119848 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 6-hydroxy-2,3,7-trimethylnon-5-en-4-one |
| SMILES | CCC(C)C(O)=CC(=O)C(C)C(C)C |
| InChI | InChI=1S/C12H22O2/c1-6-9(4)11(13)7-12(14)10(5)8(2)3/h7-10,13H,6H2,1-5H3 |
| InChIKey | JARNBXOAVRWPQZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-2,3,7-trimethylnon-5-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,3,7-trimethylnon-5-en-4-one?
The IUPAC name of 6-hydroxy-2,3,7-trimethylnon-5-en-4-one (CID 177119848) is 6-hydroxy-2,3,7-trimethylnon-5-en-4-one.
What is the SMILES notation for 6-hydroxy-2,3,7-trimethylnon-5-en-4-one?
The canonical SMILES for 6-hydroxy-2,3,7-trimethylnon-5-en-4-one is CCC(C)C(O)=CC(=O)C(C)C(C)C.
What is the InChIKey of 6-hydroxy-2,3,7-trimethylnon-5-en-4-one?
The InChIKey is JARNBXOAVRWPQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-6-9(4)11(13)7-12(14)10(5)8(2)3/h7-10,13H,6H2,1-5H3.
What are the key properties of 6-hydroxy-2,3,7-trimethylnon-5-en-4-one?
6-hydroxy-2,3,7-trimethylnon-5-en-4-one has a molecular weight of 198.31 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,3,7-trimethylnon-5-en-4-one is sourced from PubChem (CID 177119848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).