C30H46O5 — CID 177120171
[(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(3,5-dimethyl-1-adamantyl)acetate (PubChem CID 177120171) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(3,5-dimethyl-1-adamantyl)acetate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(3,5-dimethyl-1-adamantyl)acetate |
|---|---|
| PubChem CID | 177120171 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 2-(3,5-dimethyl-1-adamantyl)acetate |
| SMILES | CO[C@@H]1[C@H](OC(=O)CC23CC4CC(C)(CC(C)(C4)C2)C3)CC[C@]2(CO2)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C30H46O5/c1-19(2)7-8-22-28(5,35-22)25-24(32-6)21(9-10-30(25)18-33-30)34-23(31)14-29-13-20-11-26(3,16-29)15-27(4,12-20)17-29/h7,20-22,24-25H,8-18H2,1-6H3/t20?,21-,22-,24-,25-,26?,27?,28+,29?,30+/m1/s1 |
| InChIKey | OCMVNJYOFMOBJS-CLPXAOKVSA-N |
| XLogP | 5.99 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|