C26H34O18 — CID 177120183
bis[[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]methyl] butanedioate (PubChem CID 177120183) has the molecular formula C26H34O18 and a molecular weight of 634.54 g/mol. Its IUPAC name is bis[[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]methyl] butanedioate.
| Compound Name | bis[[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]methyl] butanedioate |
|---|---|
| PubChem CID | 177120183 |
| Molecular Formula | C26H34O18 |
| Molecular Weight | 634.54 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | bis[[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]methyl] butanedioate |
| SMILES | CC(=O)O[C@@H]1O[C@H](COC(=O)CCC(=O)OC[C@H]2O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H34O18/c1-11(27)37-21-17(43-25(41-15(5)31)23(21)39-13(3)29)9-35-19(33)7-8-20(34)36-10-18-22(38-12(2)28)24(40-14(4)30)26(44-18)42-16(6)32/h17-18,21-26H,7-10H2,1-6H3/t17-,18-,21-,22-,23-,24-,25-,26-/m1/s1 |
| InChIKey | WSTXGSPJNJRRSY-PUBZKYEPSA-N |
| XLogP | -0.84 |
| TPSA | 228.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.54 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|