C19H22FN3O6S — CID 177120421
5-[(7Z)-4-fluoro-7-(isocyanomethylidene)-2-(2-methoxyethoxymethoxy)-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 177120421) has the molecular formula C19H22FN3O6S and a molecular weight of 439.47 g/mol. Its IUPAC name is 5-[(7Z)-4-fluoro-7-(isocyanomethylidene)-2-(2-methoxyethoxymethoxy)-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(7Z)-4-fluoro-7-(isocyanomethylidene)-2-(2-methoxyethoxymethoxy)-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 177120421 |
| Molecular Formula | C19H22FN3O6S |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 5-[(7Z)-4-fluoro-7-(isocyanomethylidene)-2-(2-methoxyethoxymethoxy)-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | [C-]#[N+]/C=C1/CCc2cc(OCOCCOC)c(N3CC(=O)NS3(=O)=O)c(F)c2CC1 |
| InChI | InChI=1S/C19H22FN3O6S/c1-21-10-13-3-5-14-9-16(29-12-28-8-7-27-2)19(18(20)15(14)6-4-13)23-11-17(24)22-30(23,25)26/h9-10H,3-8,11-12H2,2H3,(H,22,24)/b13-10- |
| InChIKey | XKOFTBUBWDASFC-RAXLEYEMSA-N |
| XLogP | 1.69 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|