About 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine
8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 177120441) has the molecular formula C10H11BrFN
and a molecular weight of 244.11 g/mol. Its IUPAC name is 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine.
Molecular Properties
| Compound Name | 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine |
| PubChem CID | 177120441 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | Fc1cc(Br)cc2c1CCNCC2 |
| InChI | InChI=1S/C10H11BrFN/c11-8-5-7-1-3-13-4-2-9(7)10(12)6-8/h5-6,13H,1-4H2 |
| InChIKey | DQSIBDCAJBTSKT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine?
The IUPAC name of 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine (CID 177120441) is 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine.
What is the SMILES notation for 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine?
The canonical SMILES for 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine is Fc1cc(Br)cc2c1CCNCC2.
What is the InChIKey of 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine?
The InChIKey is DQSIBDCAJBTSKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrFN/c11-8-5-7-1-3-13-4-2-9(7)10(12)6-8/h5-6,13H,1-4H2.
What are the key properties of 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine?
8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine has a molecular weight of 244.11 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6-fluoro-2,3,4,5-tetrahydro-1H-3-benzazepine is sourced from PubChem (CID 177120441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).