C19H20FN3O5 — CID 177120686
[(2R,3S,4S)-4-hydroxy-2-[(4-nitrophenyl)methyl]pyrrolidin-3-yl] N-[(3-fluorophenyl)methyl]carbamate (PubChem CID 177120686) has the molecular formula C19H20FN3O5 and a molecular weight of 389.38 g/mol. Its IUPAC name is [(2R,3S,4S)-4-hydroxy-2-[(4-nitrophenyl)methyl]pyrrolidin-3-yl] N-[(3-fluorophenyl)methyl]carbamate.
| Compound Name | [(2R,3S,4S)-4-hydroxy-2-[(4-nitrophenyl)methyl]pyrrolidin-3-yl] N-[(3-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 177120686 |
| Molecular Formula | C19H20FN3O5 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [(2R,3S,4S)-4-hydroxy-2-[(4-nitrophenyl)methyl]pyrrolidin-3-yl] N-[(3-fluorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1cccc(F)c1)O[C@@H]1[C@@H](O)CN[C@@H]1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20FN3O5/c20-14-3-1-2-13(8-14)10-22-19(25)28-18-16(21-11-17(18)24)9-12-4-6-15(7-5-12)23(26)27/h1-8,16-18,21,24H,9-11H2,(H,22,25)/t16-,17+,18+/m1/s1 |
| InChIKey | PTPUUVOKIFOOLV-SQNIBIBYSA-N |
| XLogP | 1.90 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|