C24H28FN3O7 — CID 177120716
tert-butyl (2R,3S,4S)-3-[(3-fluorophenyl)methylcarbamoyloxy]-4-hydroxy-2-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 177120716) has the molecular formula C24H28FN3O7 and a molecular weight of 489.50 g/mol. Its IUPAC name is tert-butyl (2R,3S,4S)-3-[(3-fluorophenyl)methylcarbamoyloxy]-4-hydroxy-2-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4S)-3-[(3-fluorophenyl)methylcarbamoyloxy]-4-hydroxy-2-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177120716 |
| Molecular Formula | C24H28FN3O7 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | tert-butyl (2R,3S,4S)-3-[(3-fluorophenyl)methylcarbamoyloxy]-4-hydroxy-2-[(4-nitrophenyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)[C@@H](OC(=O)NCc2cccc(F)c2)[C@H]1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H28FN3O7/c1-24(2,3)35-23(31)27-14-20(29)21(19(27)12-15-7-9-18(10-8-15)28(32)33)34-22(30)26-13-16-5-4-6-17(25)11-16/h4-11,19-21,29H,12-14H2,1-3H3,(H,26,30)/t19-,20+,21+/m1/s1 |
| InChIKey | XKCGMYUMLMVXJG-HKBOAZHASA-N |
| XLogP | 3.55 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|