C61H110N2O14 — CID 177121075
2-(dipropylamino)ethyl (2R,5S)-2,5-bis[[4-nonanoyloxy-3-(nonanoyloxymethyl)butanoyl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 177121075) has the molecular formula C61H110N2O14 and a molecular weight of 1095.55 g/mol. Its IUPAC name is 2-(dipropylamino)ethyl (2R,5S)-2,5-bis[[4-nonanoyloxy-3-(nonanoyloxymethyl)butanoyl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | 2-(dipropylamino)ethyl (2R,5S)-2,5-bis[[4-nonanoyloxy-3-(nonanoyloxymethyl)butanoyl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177121075 |
| Molecular Formula | C61H110N2O14 |
| Molecular Weight | 1095.55 g/mol |
| Exact Mass | 1094.80 |
| IUPAC Name | 2-(dipropylamino)ethyl (2R,5S)-2,5-bis[[4-nonanoyloxy-3-(nonanoyloxymethyl)butanoyl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)CC(=O)OC[C@H]1CC[C@@H](COC(=O)CC(COC(=O)CCCCCCCC)COC(=O)CCCCCCCC)N1C(=O)OCCN(CCC)CCC |
| InChI | InChI=1S/C61H110N2O14/c1-7-13-17-21-25-29-33-55(64)72-45-51(46-73-56(65)34-30-26-22-18-14-8-2)43-59(68)76-49-53-37-38-54(63(53)61(70)71-42-41-62(39-11-5)40-12-6)50-77-60(69)44-52(47-74-57(66)35-31-27-23-19-15-9-3)48-75-58(67)36-32-28-24-20-16-10-4/h51-54H,7-50H2,1-6H3/t53-,54+ |
| InChIKey | QGOSJMXUVFLQSU-BCCSUNCUSA-N |
| XLogP | 13.35 |
| TPSA | 190.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.55 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|