C24H31N5O2 — CID 177123129
N-[3-(4-cyano-2,3-dimethylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-3-propan-2-yl-1,2,4-triazine-6-carboxamide (PubChem CID 177123129) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-[3-(4-cyano-2,3-dimethylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-3-propan-2-yl-1,2,4-triazine-6-carboxamide.
| Compound Name | N-[3-(4-cyano-2,3-dimethylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-3-propan-2-yl-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 177123129 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | N-[3-(4-cyano-2,3-dimethylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-3-propan-2-yl-1,2,4-triazine-6-carboxamide |
| SMILES | Cc1c(C#N)ccc(OC2C(C)(C)C(NC(=O)c3cnc(C(C)C)nn3)C2(C)C)c1C |
| InChI | InChI=1S/C24H31N5O2/c1-13(2)19-26-12-17(28-29-19)20(30)27-21-23(5,6)22(24(21,7)8)31-18-10-9-16(11-25)14(3)15(18)4/h9-10,12-13,21-22H,1-8H3,(H,27,30) |
| InChIKey | CDTLXKCEKGLHNY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |