C12H15N3 — CID 177123763
2-tert-butyl-7-methylpyrido[4,3-d]pyrimidine (PubChem CID 177123763) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-tert-butyl-7-methylpyrido[4,3-d]pyrimidine.
| Compound Name | 2-tert-butyl-7-methylpyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 177123763 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-tert-butyl-7-methylpyrido[4,3-d]pyrimidine |
| SMILES | Cc1cc2nc(C(C)(C)C)ncc2cn1 |
| InChI | InChI=1S/C12H15N3/c1-8-5-10-9(6-13-8)7-14-11(15-10)12(2,3)4/h5-7H,1-4H3 |
| InChIKey | MWDHBPHNIGUZBD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |