C22H22ClNO4 — CID 177124113
3-(2-chlorophenyl)-6,8-dihydroxy-5-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-4H-naphthalen-1-one (PubChem CID 177124113) has the molecular formula C22H22ClNO4 and a molecular weight of 399.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-6,8-dihydroxy-5-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-4H-naphthalen-1-one.
| Compound Name | 3-(2-chlorophenyl)-6,8-dihydroxy-5-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 177124113 |
| Molecular Formula | C22H22ClNO4 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-(2-chlorophenyl)-6,8-dihydroxy-5-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]-4H-naphthalen-1-one |
| SMILES | CN1CC[C@@H](c2c(O)cc(O)c3c2CC(c2ccccc2Cl)=CC3=O)[C@@H]1CO |
| InChI | InChI=1S/C22H22ClNO4/c1-24-7-6-14(17(24)11-25)21-15-8-12(13-4-2-3-5-16(13)23)9-18(26)22(15)20(28)10-19(21)27/h2-5,9-10,14,17,25,27-28H,6-8,11H2,1H3/t14-,17+/m1/s1 |
| InChIKey | YYMXWYLVBWFDAZ-PBHICJAKSA-N |
| XLogP | 3.35 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'} |
|---|