C33H52N8O3 — CID 177124270
4-[[[8-[[4-(2-methylpropanoyl)phenyl]methylamino]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]methyl]benzoic acid (PubChem CID 177124270) has the molecular formula C33H52N8O3 and a molecular weight of 608.83 g/mol. Its IUPAC name is 4-[[[8-[[4-(2-methylpropanoyl)phenyl]methylamino]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[8-[[4-(2-methylpropanoyl)phenyl]methylamino]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 177124270 |
| Molecular Formula | C33H52N8O3 |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.42 |
| IUPAC Name | 4-[[[8-[[4-(2-methylpropanoyl)phenyl]methylamino]-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosan-1-yl]amino]methyl]benzoic acid |
| SMILES | CC(C)C(=O)c1ccc(CNC23CNCCNCC(NCc4ccc(C(=O)O)cc4)(CNCCNC2)CNCCNC3)cc1 |
| InChI | InChI=1S/C33H52N8O3/c1-25(2)30(42)28-7-3-26(4-8-28)17-40-32-19-34-11-14-37-22-33(23-38-15-12-35-20-32,24-39-16-13-36-21-32)41-18-27-5-9-29(10-6-27)31(43)44/h3-10,25,34-41H,11-24H2,1-2H3,(H,43,44) |
| InChIKey | IYOQQFHDMLCPTG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 150.61 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |