C30H24NO2+ — CID 177124559
3-methyl-2-(2,9,9-trimethylfluoren-1-yl)-[1]benzofuro[2,3-g][1,3]benzoxazol-3-ium (PubChem CID 177124559) has the molecular formula C30H24NO2+ and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-methyl-2-(2,9,9-trimethylfluoren-1-yl)-[1]benzofuro[2,3-g][1,3]benzoxazol-3-ium.
| Compound Name | 3-methyl-2-(2,9,9-trimethylfluoren-1-yl)-[1]benzofuro[2,3-g][1,3]benzoxazol-3-ium |
|---|---|
| PubChem CID | 177124559 |
| Molecular Formula | C30H24NO2+ |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 3-methyl-2-(2,9,9-trimethylfluoren-1-yl)-[1]benzofuro[2,3-g][1,3]benzoxazol-3-ium |
| SMILES | Cc1ccc2c(c1-c1oc3c4c(ccc3[n+]1C)oc1ccccc14)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C30H24NO2/c1-17-13-14-19-18-9-5-7-11-21(18)30(2,3)27(19)25(17)29-31(4)22-15-16-24-26(28(22)33-29)20-10-6-8-12-23(20)32-24/h5-16H,1-4H3/q+1 |
| InChIKey | NNTLKQKUAXPAJX-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|