C26H16N4S2 — CID 177124744
(2Z)-2-[(12E)-12-[cyano(isocyano)methylidene]-6,16-dimethyl-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-4(9),5,7,14(19),15,17-hexaen-2-ylidene]-2-isocyanoacetonitrile (PubChem CID 177124744) has the molecular formula C26H16N4S2 and a molecular weight of 448.58 g/mol. Its IUPAC name is (2Z)-2-[(12E)-12-[cyano(isocyano)methylidene]-6,16-dimethyl-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-4(9),5,7,14(19),15,17-hexaen-2-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[(12E)-12-[cyano(isocyano)methylidene]-6,16-dimethyl-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-4(9),5,7,14(19),15,17-hexaen-2-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 177124744 |
| Molecular Formula | C26H16N4S2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | (2Z)-2-[(12E)-12-[cyano(isocyano)methylidene]-6,16-dimethyl-10,20-dithiapentacyclo[11.7.0.03,11.04,9.014,19]icosa-4(9),5,7,14(19),15,17-hexaen-2-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\C2Sc3ccc(C)cc3C2/C(=C(/C#N)[N+]#[C-])C2Sc3ccc(C)cc3C12 |
| InChI | InChI=1S/C26H16N4S2/c1-13-5-7-19-15(9-13)21-23(17(11-27)29-3)26-22(16-10-14(2)6-8-20(16)32-26)24(25(21)31-19)18(12-28)30-4/h5-10,21-22,25-26H,1-2H3/b23-17-,24-18+ |
| InChIKey | QTEDZWRHSCXSGY-QFFDILLMSA-N |
| XLogP | 6.53 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|