About 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole
1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole (PubChem CID 177125130) has the molecular formula C11H11F2N3O
and a molecular weight of 239.23 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole.
Molecular Properties
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole |
| PubChem CID | 177125130 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole |
| SMILES | Cc1nnn(-c2ccc(OC(F)F)cc2)c1C |
| InChI | InChI=1S/C11H11F2N3O/c1-7-8(2)16(15-14-7)9-3-5-10(6-4-9)17-11(12)13/h3-6,11H,1-2H3 |
| InChIKey | LTAGPFBULUJCIU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole?
The IUPAC name of 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole (CID 177125130) is 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole.
What is the SMILES notation for 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole?
The canonical SMILES for 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole is Cc1nnn(-c2ccc(OC(F)F)cc2)c1C.
What is the InChIKey of 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole?
The InChIKey is LTAGPFBULUJCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N3O/c1-7-8(2)16(15-14-7)9-3-5-10(6-4-9)17-11(12)13/h3-6,11H,1-2H3.
What are the key properties of 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole?
1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole has a molecular weight of 239.23 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(difluoromethoxy)phenyl]-4,5-dimethyltriazole is sourced from PubChem (CID 177125130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).