C25H31Cl2N5O4S+2 — CID 177125169
[6-azaniumyl-1-[[5-(4-chlorobenzoyl)imino-2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazolidin-4-yl]methoxy]-1-oxohexan-2-yl]-dimethylazanium (PubChem CID 177125169) has the molecular formula C25H31Cl2N5O4S+2 and a molecular weight of 568.53 g/mol. Its IUPAC name is [6-azaniumyl-1-[[5-(4-chlorobenzoyl)imino-2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazolidin-4-yl]methoxy]-1-oxohexan-2-yl]-dimethylazanium.
| Compound Name | [6-azaniumyl-1-[[5-(4-chlorobenzoyl)imino-2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazolidin-4-yl]methoxy]-1-oxohexan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 177125169 |
| Molecular Formula | C25H31Cl2N5O4S+2 |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | [6-azaniumyl-1-[[5-(4-chlorobenzoyl)imino-2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazolidin-4-yl]methoxy]-1-oxohexan-2-yl]-dimethylazanium |
| SMILES | C[NH+](C)C(CCCC[NH3+])C(=O)OCn1c(=O)n(Cc2ccc(Cl)cc2)s/c1=N\C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H29Cl2N5O4S/c1-30(2)21(5-3-4-14-28)23(34)36-16-31-24(29-22(33)18-8-12-20(27)13-9-18)37-32(25(31)35)15-17-6-10-19(26)11-7-17/h6-13,21H,3-5,14-16,28H2,1-2H3/p+2/b29-24- |
| InChIKey | DIWWSCTYFDDMOF-OLFWJLLRSA-P |
| XLogP | 1.23 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|