C28H36BN7O4 — CID 177125617
tert-butyl (3S)-4-[7-(4-isocyano-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 177125617) has the molecular formula C28H36BN7O4 and a molecular weight of 545.45 g/mol. Its IUPAC name is tert-butyl (3S)-4-[7-(4-isocyano-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[7-(4-isocyano-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 177125617 |
| Molecular Formula | C28H36BN7O4 |
| Molecular Weight | 545.45 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | tert-butyl (3S)-4-[7-(4-isocyano-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidin-4-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccnc(-n2cc(B3OC(C)(C)C(C)(C)O3)c3c(N4CCN(C(=O)OC(C)(C)C)C[C@@H]4C)ncnc32)c1 |
| InChI | InChI=1S/C28H36BN7O4/c1-18-15-34(25(37)38-26(2,3)4)12-13-35(18)23-22-20(29-39-27(5,6)28(7,8)40-29)16-36(24(22)33-17-32-23)21-14-19(30-9)10-11-31-21/h10-11,14,16-18H,12-13,15H2,1-8H3/t18-/m0/s1 |
| InChIKey | RPBFJAZHODRRCM-SFHVURJKSA-N |
| XLogP | 4.11 |
| TPSA | 99.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|