About (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane]
(5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane] (PubChem CID 177126242) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane].
Molecular Properties
| Compound Name | (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane] |
| PubChem CID | 177126242 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane] |
| SMILES | CC(C)OC[C@]12CCN1CC1(CC1)C2 |
| InChI | InChI=1S/C12H21NO/c1-10(2)14-9-12-5-6-13(12)8-11(7-12)3-4-11/h10H,3-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | QSDVRYMPDCMYDG-GFCCVEGCSA-N |
| XLogP | 2.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane]?
The IUPAC name of (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane] (CID 177126242) is (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane].
What is the SMILES notation for (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane]?
The canonical SMILES for (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane] is CC(C)OC[C@]12CCN1CC1(CC1)C2.
What is the InChIKey of (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane]?
The InChIKey is QSDVRYMPDCMYDG-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H21NO/c1-10(2)14-9-12-5-6-13(12)8-11(7-12)3-4-11/h10H,3-9H2,1-2H3/t12-/m1/s1.
What are the key properties of (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane]?
(5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane] has a molecular weight of 195.31 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(propan-2-yloxymethyl)spiro[1-azabicyclo[3.2.0]heptane-3,1'-cyclopropane] is sourced from PubChem (CID 177126242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).