About 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine
3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine (PubChem CID 177126288) has the molecular formula C10H20FNO
and a molecular weight of 189.27 g/mol. Its IUPAC name is 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine.
Molecular Properties
| Compound Name | 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine |
| PubChem CID | 177126288 |
| Molecular Formula | C10H20FNO |
| Molecular Weight | 189.27 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine |
| SMILES | CC(C)OCC1(C)C(F)CCN1C |
| InChI | InChI=1S/C10H20FNO/c1-8(2)13-7-10(3)9(11)5-6-12(10)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | VSEJYFZBTJAOIH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine?
The IUPAC name of 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine (CID 177126288) is 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine.
What is the SMILES notation for 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine?
The canonical SMILES for 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine is CC(C)OCC1(C)C(F)CCN1C.
What is the InChIKey of 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine?
The InChIKey is VSEJYFZBTJAOIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20FNO/c1-8(2)13-7-10(3)9(11)5-6-12(10)4/h8-9H,5-7H2,1-4H3.
What are the key properties of 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine?
3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine has a molecular weight of 189.27 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,2-dimethyl-2-(propan-2-yloxymethyl)pyrrolidine is sourced from PubChem (CID 177126288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).