C41H50N8O4 — CID 177126565
2-butan-2-yl-4-[9-[4-[4-[[7-(4-hydroxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrazol-1-yl]piperidin-1-yl]nonoxy]isoindole-1,3-dione (PubChem CID 177126565) has the molecular formula C41H50N8O4 and a molecular weight of 718.90 g/mol. Its IUPAC name is 2-butan-2-yl-4-[9-[4-[4-[[7-(4-hydroxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrazol-1-yl]piperidin-1-yl]nonoxy]isoindole-1,3-dione.
| Compound Name | 2-butan-2-yl-4-[9-[4-[4-[[7-(4-hydroxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrazol-1-yl]piperidin-1-yl]nonoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 177126565 |
| Molecular Formula | C41H50N8O4 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.40 |
| IUPAC Name | 2-butan-2-yl-4-[9-[4-[4-[[7-(4-hydroxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]pyrazol-1-yl]piperidin-1-yl]nonoxy]isoindole-1,3-dione |
| SMILES | CCC(C)N1C(=O)c2cccc(OCCCCCCCCCN3CCC(n4cc(Nc5ncc6ccc(-c7ccc(O)cc7)n6n5)cn4)CC3)c2C1=O |
| InChI | InChI=1S/C41H50N8O4/c1-3-29(2)48-39(51)35-12-11-13-37(38(35)40(48)52)53-25-10-8-6-4-5-7-9-22-46-23-20-32(21-24-46)47-28-31(26-43-47)44-41-42-27-33-16-19-36(49(33)45-41)30-14-17-34(50)18-15-30/h11-19,26-29,32,50H,3-10,20-25H2,1-2H3,(H,44,45) |
| InChIKey | SBOGZYHSGCPWMV-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|