C45H28O — CID 177126977
4-[9-naphthalen-2-yl-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-2-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene (PubChem CID 177126977) has the molecular formula C45H28O and a molecular weight of 589.75 g/mol. Its IUPAC name is 4-[9-naphthalen-2-yl-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-2-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene.
| Compound Name | 4-[9-naphthalen-2-yl-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-2-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 177126977 |
| Molecular Formula | C45H28O |
| Molecular Weight | 589.75 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | 4-[9-naphthalen-2-yl-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-2-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3ccc4ccccc4c3)c3ccccc3-c3ccc(-c4ccc5c(c4)-c4cccc6cccc(c46)O5)cc32)c([2H])c1[2H] |
| InChI | InChI=1S/C45H28O/c1-2-14-34(15-3-1)45(35-23-20-29-10-4-5-11-31(29)26-35)40-18-7-6-16-36(40)37-24-21-33(28-41(37)45)32-22-25-42-39(27-32)38-17-8-12-30-13-9-19-43(46-42)44(30)38/h1-28H/i1D,2D,3D,14D,15D |
| InChIKey | MSYYTPRVZXTHRE-IRYSBDQPSA-N |
| XLogP | 11.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.75 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |