C34H23F2NS — CID 177127776
1-(3,5-difluorophenyl)-2-ethenyl-3-[(E)-2-(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)ethenyl]-2,3-dihydroindole (PubChem CID 177127776) has the molecular formula C34H23F2NS and a molecular weight of 515.63 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-2-ethenyl-3-[(E)-2-(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)ethenyl]-2,3-dihydroindole.
| Compound Name | 1-(3,5-difluorophenyl)-2-ethenyl-3-[(E)-2-(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)ethenyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 177127776 |
| Molecular Formula | C34H23F2NS |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 1-(3,5-difluorophenyl)-2-ethenyl-3-[(E)-2-(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-4-yl)ethenyl]-2,3-dihydroindole |
| SMILES | C=CC1C(/C=C/c2ccc3c(c2)-c2cccc4cccc(c24)S3)c2ccccc2N1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C34H23F2NS/c1-2-30-27(26-9-3-4-11-31(26)37(30)25-19-23(35)18-24(36)20-25)15-13-21-14-16-32-29(17-21)28-10-5-7-22-8-6-12-33(38-32)34(22)28/h2-20,27,30H,1H2/b15-13+ |
| InChIKey | LKVMMRGVGOHURL-FYWRMAATSA-N |
| XLogP | 9.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|