C45H28N4O — CID 177129611
1,2,3,4,5,6,8-heptadeuterio-7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-(9-phenyldibenzofuran-3-yl)carbazole (PubChem CID 177129611) has the molecular formula C45H28N4O and a molecular weight of 647.79 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-(9-phenyldibenzofuran-3-yl)carbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-(9-phenyldibenzofuran-3-yl)carbazole |
|---|---|
| PubChem CID | 177129611 |
| Molecular Formula | C45H28N4O |
| Molecular Weight | 647.79 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-(9-phenyldibenzofuran-3-yl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c([2H])c1n2-c1ccc2c(c1)oc1cccc(-c3ccccc3)c12 |
| InChI | InChI=1S/C45H28N4O/c1-4-13-29(14-5-1)34-20-12-22-40-42(34)37-26-24-33(28-41(37)50-40)49-38-21-11-10-19-35(38)36-25-23-32(27-39(36)49)45-47-43(30-15-6-2-7-16-30)46-44(48-45)31-17-8-3-9-18-31/h1-28H/i10D,11D,19D,21D,23D,25D,27D |
| InChIKey | RJQHTWAYYJMZHZ-GPNRIMSUSA-N |
| XLogP | 11.54 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.79 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |