5-pentadecylfuran-2-carboxylic acid

C20H34O3 — CID 177129672

IUPAC5-pentadecylfuran-2-carboxylic acid
SMILESCCCCCCCCCCCCCCCc1ccc(C(=O)O)o1
InChIInChI=1S/C20H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16-17-19(23-18)20(21)22/h16-17H,2-15H2,1H3,(H,21,22)
InChIKeyRKUSBVNSLGAYKF-UHFFFAOYSA-N
MW322.49 g/mol
LogP6.61
Rot. Bonds15

About 5-pentadecylfuran-2-carboxylic acid

5-pentadecylfuran-2-carboxylic acid (PubChem CID 177129672) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 5-pentadecylfuran-2-carboxylic acid.

Molecular Properties

Compound Name5-pentadecylfuran-2-carboxylic acid
PubChem CID177129672
Molecular FormulaC20H34O3
Molecular Weight322.49 g/mol
Exact Mass322.25
IUPAC Name5-pentadecylfuran-2-carboxylic acid
SMILESCCCCCCCCCCCCCCCc1ccc(C(=O)O)o1
InChIInChI=1S/C20H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16-17-19(23-18)20(21)22/h16-17H,2-15H2,1H3,(H,21,22)
InChIKeyRKUSBVNSLGAYKF-UHFFFAOYSA-N
XLogP6.61
TPSA50.44 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds15
Heavy Atoms23
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500322.49
LogP ≤ 56.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-pentadecylfuran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-hexylfuran-2-carboxylic acid
CID 86015959
5-(4-phenylbutyl)furan-2-carboxylic acid
CID 86713049
2-(5-hexylfuran-2-yl)acetic acid
CID 10954815
5-(tetradecoxymethyl)furan-2-carboxylic acid
CID 22152429
acetic acid;8-(5-hexylfuran-2-yl)octan-1-ol
CID 71319263
5-(3-butoxy-3-oxopropyl)furan-2-carboxylic acid
CID 170990527
bis(5-octadecylfuran-2-yl)iodanium
CID 139729189
5-decylsulfanylfuran-2-carboxylic acid
CID 21327068
(5-tetradecylfuran-2-yl)methanesulfonic acid
CID 155313093
2-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-hexylfuran
CID 143267656
5-(1-hydroxyheptyl)furan-2-carboxylic acid
CID 12718415
5-pentylsulfanylfuran-2-carboxylic acid
CID 21162492

Frequently Asked Questions

What is the IUPAC name of 5-pentadecylfuran-2-carboxylic acid?
The IUPAC name of 5-pentadecylfuran-2-carboxylic acid (CID 177129672) is 5-pentadecylfuran-2-carboxylic acid.
What is the SMILES notation for 5-pentadecylfuran-2-carboxylic acid?
The canonical SMILES for 5-pentadecylfuran-2-carboxylic acid is CCCCCCCCCCCCCCCc1ccc(C(=O)O)o1.
What is the InChIKey of 5-pentadecylfuran-2-carboxylic acid?
The InChIKey is RKUSBVNSLGAYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16-17-19(23-18)20(21)22/h16-17H,2-15H2,1H3,(H,21,22).
What are the key properties of 5-pentadecylfuran-2-carboxylic acid?
5-pentadecylfuran-2-carboxylic acid has a molecular weight of 322.49 g/mol, XLogP of 6.61, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentadecylfuran-2-carboxylic acid is sourced from PubChem (CID 177129672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).