C16H17ClN5O4+ — CID 177129694
3-[[3-[(2R)-2-(4-chlorophenyl)-1,1-dideuterio-2-hydroxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-1,5-dimethyl-1,3,5-triazin-1-ium-2,4-dione (PubChem CID 177129694) has the molecular formula C16H17ClN5O4+ and a molecular weight of 380.81 g/mol. Its IUPAC name is 3-[[3-[(2R)-2-(4-chlorophenyl)-1,1-dideuterio-2-hydroxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-1,5-dimethyl-1,3,5-triazin-1-ium-2,4-dione.
| Compound Name | 3-[[3-[(2R)-2-(4-chlorophenyl)-1,1-dideuterio-2-hydroxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-1,5-dimethyl-1,3,5-triazin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 177129694 |
| Molecular Formula | C16H17ClN5O4+ |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3-[[3-[(2R)-2-(4-chlorophenyl)-1,1-dideuterio-2-hydroxyethyl]-1,2,4-oxadiazol-5-yl]methyl]-1,5-dimethyl-1,3,5-triazin-1-ium-2,4-dione |
| SMILES | [2H]C([2H])(c1noc(Cn2c(=O)n(C)c[n+](C)c2=O)n1)[C@@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN5O4/c1-20-9-21(2)16(25)22(15(20)24)8-14-18-13(19-26-14)7-12(23)10-3-5-11(17)6-4-10/h3-6,9,12,23H,7-8H2,1-2H3/q+1/t12-/m1/s1/i7D2 |
| InChIKey | GYKBXCWRHTYEJB-YDYFSBEESA-N |
| XLogP | -0.27 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|