About 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione
3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione (PubChem CID 177129737) has the molecular formula C10H15FN2O2
and a molecular weight of 214.24 g/mol. Its IUPAC name is 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione |
| PubChem CID | 177129737 |
| Molecular Formula | C10H15FN2O2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1c(F)c(=O)n(C(C)(C)C)c(=O)n1C |
| InChI | InChI=1S/C10H15FN2O2/c1-6-7(11)8(14)13(10(2,3)4)9(15)12(6)5/h1-5H3 |
| InChIKey | DVISTRKHWYIINO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione?
The IUPAC name of 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione (CID 177129737) is 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione is Cc1c(F)c(=O)n(C(C)(C)C)c(=O)n1C.
What is the InChIKey of 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione?
The InChIKey is DVISTRKHWYIINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2O2/c1-6-7(11)8(14)13(10(2,3)4)9(15)12(6)5/h1-5H3.
What are the key properties of 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione?
3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione has a molecular weight of 214.24 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-fluoro-1,6-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 177129737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).