C22H15N5O — CID 177130207
5-(3-hydroxy-2,6-dimethylphenyl)-2-(5-isocyano-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile (PubChem CID 177130207) has the molecular formula C22H15N5O and a molecular weight of 365.40 g/mol. Its IUPAC name is 5-(3-hydroxy-2,6-dimethylphenyl)-2-(5-isocyano-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile.
| Compound Name | 5-(3-hydroxy-2,6-dimethylphenyl)-2-(5-isocyano-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 177130207 |
| Molecular Formula | C22H15N5O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 5-(3-hydroxy-2,6-dimethylphenyl)-2-(5-isocyano-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile |
| SMILES | [C-]#[N+]c1cncc(-c2cc3c(C#N)c(-c4c(C)ccc(O)c4C)cnc3[nH]2)c1 |
| InChI | InChI=1S/C22H15N5O/c1-12-4-5-20(28)13(2)21(12)18-11-26-22-16(17(18)8-23)7-19(27-22)14-6-15(24-3)10-25-9-14/h4-7,9-11,28H,1-2H3,(H,26,27) |
| InChIKey | VEKQTHJVQACPIZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|