C57H35N5S — CID 177130636
9-[2-[4-(4-carbazol-9-ylphenyl)-6-(3-dibenzothiophen-4-ylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,2,3,4,5,6,8-heptadeuteriocarbazole (PubChem CID 177130636) has the molecular formula C57H35N5S and a molecular weight of 829.05 g/mol. Its IUPAC name is 9-[2-[4-(4-carbazol-9-ylphenyl)-6-(3-dibenzothiophen-4-ylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,2,3,4,5,6,8-heptadeuteriocarbazole.
| Compound Name | 9-[2-[4-(4-carbazol-9-ylphenyl)-6-(3-dibenzothiophen-4-ylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,2,3,4,5,6,8-heptadeuteriocarbazole |
|---|---|
| PubChem CID | 177130636 |
| Molecular Formula | C57H35N5S |
| Molecular Weight | 829.05 g/mol |
| Exact Mass | 828.31 |
| IUPAC Name | 9-[2-[4-(4-carbazol-9-ylphenyl)-6-(3-dibenzothiophen-4-ylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,2,3,4,5,6,8-heptadeuteriocarbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1ccccc1-c1nc(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)nc(-c2cccc(-c3cccc4c3sc3ccccc34)c2)n1 |
| InChI | InChI=1S/C57H35N5S/c1-7-25-48-41(17-1)42-18-2-8-26-49(42)61(48)39-33-31-36(32-34-39)55-58-56(38-16-13-15-37(35-38)40-23-14-24-46-45-21-6-12-30-53(45)63-54(40)46)60-57(59-55)47-22-5-11-29-52(47)62-50-27-9-3-19-43(50)44-20-4-10-28-51(44)62/h1-35H/i3D,4D,9D,19D,20D,27D,28D |
| InChIKey | LCSINVIKYQIALQ-KOQQCWMLSA-N |
| XLogP | 15.10 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.05 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |