C14H8F3I2O5S- — CID 177131574
2,6-diiodo-4-[2-(2,4,6-trifluorophenoxy)ethoxy]benzenesulfonate (PubChem CID 177131574) has the molecular formula C14H8F3I2O5S- and a molecular weight of 599.08 g/mol. Its IUPAC name is 2,6-diiodo-4-[2-(2,4,6-trifluorophenoxy)ethoxy]benzenesulfonate.
| Compound Name | 2,6-diiodo-4-[2-(2,4,6-trifluorophenoxy)ethoxy]benzenesulfonate |
|---|---|
| PubChem CID | 177131574 |
| Molecular Formula | C14H8F3I2O5S- |
| Molecular Weight | 599.08 g/mol |
| Exact Mass | 598.81 |
| IUPAC Name | 2,6-diiodo-4-[2-(2,4,6-trifluorophenoxy)ethoxy]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(I)cc(OCCOc2c(F)cc(F)cc2F)cc1I |
| InChI | InChI=1S/C14H9F3I2O5S/c15-7-3-9(16)13(10(17)4-7)24-2-1-23-8-5-11(18)14(12(19)6-8)25(20,21)22/h3-6H,1-2H2,(H,20,21,22)/p-1 |
| InChIKey | KWSMBOPENGZOGF-UHFFFAOYSA-M |
| XLogP | 3.67 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.08 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|