C16H14I3O6S- — CID 177131643
3-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]-2,4,6-triiodobenzenesulfonate (PubChem CID 177131643) has the molecular formula C16H14I3O6S- and a molecular weight of 715.06 g/mol. Its IUPAC name is 3-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]-2,4,6-triiodobenzenesulfonate.
| Compound Name | 3-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]-2,4,6-triiodobenzenesulfonate |
|---|---|
| PubChem CID | 177131643 |
| Molecular Formula | C16H14I3O6S- |
| Molecular Weight | 715.06 g/mol |
| Exact Mass | 714.77 |
| IUPAC Name | 3-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]-2,4,6-triiodobenzenesulfonate |
| SMILES | O=C(OCCOc1c(I)cc(I)c(S(=O)(=O)[O-])c1I)C1CC2C=CC1C2 |
| InChI | InChI=1S/C16H15I3O6S/c17-11-7-12(18)15(26(21,22)23)13(19)14(11)24-3-4-25-16(20)10-6-8-1-2-9(10)5-8/h1-2,7-10H,3-6H2,(H,21,22,23)/p-1 |
| InChIKey | MZWJFCPWCHTZOB-UHFFFAOYSA-M |
| XLogP | 3.54 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.06 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|