C18H18I4O5S — CID 177131934
2-[2-(1-adamantyloxy)-2-oxoethyl]-3,4,5,6-tetraiodobenzenesulfonic acid (PubChem CID 177131934) has the molecular formula C18H18I4O5S and a molecular weight of 854.02 g/mol. Its IUPAC name is 2-[2-(1-adamantyloxy)-2-oxoethyl]-3,4,5,6-tetraiodobenzenesulfonic acid.
| Compound Name | 2-[2-(1-adamantyloxy)-2-oxoethyl]-3,4,5,6-tetraiodobenzenesulfonic acid |
|---|---|
| PubChem CID | 177131934 |
| Molecular Formula | C18H18I4O5S |
| Molecular Weight | 854.02 g/mol |
| Exact Mass | 853.71 |
| IUPAC Name | 2-[2-(1-adamantyloxy)-2-oxoethyl]-3,4,5,6-tetraiodobenzenesulfonic acid |
| SMILES | O=C(Cc1c(I)c(I)c(I)c(I)c1S(=O)(=O)O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H18I4O5S/c19-13-11(17(28(24,25)26)16(22)15(21)14(13)20)4-12(23)27-18-5-8-1-9(6-18)3-10(2-8)7-18/h8-10H,1-7H2,(H,24,25,26) |
| InChIKey | SNFYRLKNCBXNDD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|