C10H15FO — CID 177132383
[(3aR,5E)-5-(fluoromethylidene)-1,2,3,4,6,6a-hexahydropentalen-3a-yl]methanol (PubChem CID 177132383) has the molecular formula C10H15FO and a molecular weight of 170.23 g/mol. Its IUPAC name is [(3aR,5E)-5-(fluoromethylidene)-1,2,3,4,6,6a-hexahydropentalen-3a-yl]methanol.
| Compound Name | [(3aR,5E)-5-(fluoromethylidene)-1,2,3,4,6,6a-hexahydropentalen-3a-yl]methanol |
|---|---|
| PubChem CID | 177132383 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | [(3aR,5E)-5-(fluoromethylidene)-1,2,3,4,6,6a-hexahydropentalen-3a-yl]methanol |
| SMILES | OC[C@@]12CCCC1C/C(=C\F)C2 |
| InChI | InChI=1S/C10H15FO/c11-6-8-4-9-2-1-3-10(9,5-8)7-12/h6,9,12H,1-5,7H2/b8-6+/t9?,10-/m0/s1 |
| InChIKey | GVZNKPPAMDJQHV-XTDVFMGRSA-N |
| XLogP | 2.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |