C81H54N4Si — CID 177132574
3-[5-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-2,8-diphenylbenzo[b][1]benzosilol-5-yl]-9-(3-phenylphenyl)carbazole (PubChem CID 177132574) has the molecular formula C81H54N4Si and a molecular weight of 1111.44 g/mol. Its IUPAC name is 3-[5-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-2,8-diphenylbenzo[b][1]benzosilol-5-yl]-9-(3-phenylphenyl)carbazole.
| Compound Name | 3-[5-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-2,8-diphenylbenzo[b][1]benzosilol-5-yl]-9-(3-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 177132574 |
| Molecular Formula | C81H54N4Si |
| Molecular Weight | 1111.44 g/mol |
| Exact Mass | 1110.41 |
| IUPAC Name | 3-[5-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-2,8-diphenylbenzo[b][1]benzosilol-5-yl]-9-(3-phenylphenyl)carbazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc([Si]5(c6ccc7c(c6)c6ccccc6n7-c6cccc(-c7ccccc7)c6)c6ccc(-c7ccccc7)cc6-c6cc(-c7ccccc7)ccc65)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C81H54N4Si/c1-6-19-55(20-7-1)60-33-37-62(38-34-60)79-82-80(63-39-35-61(36-40-63)56-21-8-2-9-22-56)84-81(83-79)64-41-45-69(46-42-64)86(77-49-43-66(58-25-12-4-13-26-58)52-73(77)74-53-67(44-50-78(74)86)59-27-14-5-15-28-59)70-47-48-76-72(54-70)71-31-16-17-32-75(71)85(76)68-30-18-29-65(51-68)57-23-10-3-11-24-57/h1-54H |
| InChIKey | UEHHMSLCHGINRD-UHFFFAOYSA-N |
| XLogP | 17.66 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1111.44 |
| LogP ≤ 5 | 17.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|