C36H40N2O — CID 177133263
1,2,3,4-tetradeuterio-9-[4-(1,1-dideuterio-2-methylpropyl)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]-7-methoxycarbazole (PubChem CID 177133263) has the molecular formula C36H40N2O and a molecular weight of 522.77 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-9-[4-(1,1-dideuterio-2-methylpropyl)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]-7-methoxycarbazole.
| Compound Name | 1,2,3,4-tetradeuterio-9-[4-(1,1-dideuterio-2-methylpropyl)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]-7-methoxycarbazole |
|---|---|
| PubChem CID | 177133263 |
| Molecular Formula | C36H40N2O |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | 1,2,3,4-tetradeuterio-9-[4-(1,1-dideuterio-2-methylpropyl)-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]-7-methoxycarbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1ccc(OC)cc1n2-c1cc(C([2H])([2H])C(C)C)c(-c2ccc3c(c2)C(C)(C)CCC3(C)C)cn1 |
| InChI | InChI=1S/C36H40N2O/c1-23(2)18-25-20-34(38-32-11-9-8-10-27(32)28-14-13-26(39-7)21-33(28)38)37-22-29(25)24-12-15-30-31(19-24)36(5,6)17-16-35(30,3)4/h8-15,19-23H,16-18H2,1-7H3/i8D,9D,10D,11D,18D2 |
| InChIKey | CXESFRHCRVHIJG-XCYUYLDISA-N |
| XLogP | 9.40 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |