About CID 177134189
CID 177134189 (PubChem CID 177134189) has the molecular formula C18H14Cl2F4N3OS-
and a molecular weight of 467.30 g/mol.
Molecular Properties
| Compound Name | CID 177134189 |
| PubChem CID | 177134189 |
| Molecular Formula | C18H14Cl2F4N3OS- |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | — |
| SMILES | Cc1cnc(C(c2cc(F)c(F)c(Cl)c2)c2cc(F)c(F)c(Cl)c2)[nH]1.[H]N=[S-](C)=O |
| InChI | InChI=1S/C17H10Cl2F4N2.CH4NOS/c1-7-6-24-17(25-7)14(8-2-10(18)15(22)12(20)4-8)9-3-11(19)16(23)13(21)5-9;1-4(2)3/h2-6,14H,1H3,(H,24,25);2H,1H3/q;-1 |
| InChIKey | XJVGHOHZOPSZGD-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 69.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 177134189 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177134189?
The IUPAC name of CID 177134189 (CID 177134189) is not available.
What is the SMILES notation for CID 177134189?
The canonical SMILES for CID 177134189 is Cc1cnc(C(c2cc(F)c(F)c(Cl)c2)c2cc(F)c(F)c(Cl)c2)[nH]1.[H]N=[S-](C)=O.
What is the InChIKey of CID 177134189?
The InChIKey is XJVGHOHZOPSZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2F4N2.CH4NOS/c1-7-6-24-17(25-7)14(8-2-10(18)15(22)12(20)4-8)9-3-11(19)16(23)13(21)5-9;1-4(2)3/h2-6,14H,1H3,(H,24,25);2H,1H3/q;-1.
What are the key properties of CID 177134189?
CID 177134189 has a molecular weight of 467.30 g/mol, XLogP of 6.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177134189 is sourced from PubChem (CID 177134189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).